![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01. Suzie.flac | 2026-04-05 15:39 | 21M | |
| 02. Shotgun Smiles.flac | 2026-04-05 15:37 | 22M | |
| 03. Voices.flac | 2026-04-05 15:39 | 26M | |
| 04. Walk Down.flac | 2026-04-05 15:39 | 25M | |
| 05. Make A Fist.flac | 2026-04-05 15:39 | 29M | |
| 06. When I'm Small.flac | 2026-04-05 15:37 | 24M | |
| 07. Voices.flac | 2026-04-05 15:37 | 19M | |
| 08. Running From The Cops.flac | 2026-04-05 15:39 | 25M | |
| 09. Mouthful of Diamonds.flac | 2026-04-05 15:37 | 23M | |
| 10. Futuristic Casket.flac | 2026-04-05 15:39 | 22M | |
| 11. 10,000 Claps.flac | 2026-04-05 15:39 | 13M | |
| 12. You Are The Ocean.flac | 2026-04-05 15:39 | 38M | |
| 13. When I'm Small.flac | 2026-04-05 15:37 | 24M | |
| 14. Mouthful of Diamonds.flac | 2026-04-05 15:39 | 36M | |
| 15. When I'm Small.flac | 2026-04-05 15:39 | 33M | |
| 16. Mouthful of Diamonds.flac | 2026-04-05 15:39 | 22M | |